1-chloro-3-[(3-chlorophenyl)disulfanyl]benzene - Names and Identifiers
| Name | 3,3'-Dichloro Diphenyl Disulfide
|
| Synonyms | 3,3'-Dichloro 3,3'-DICHLORO DIPHEN Disulfide, bis(3-chlorophenyl) 3,3'-Dichlorodiphenyl Disulfide 1,2-bis(3-chlorophenyl)disulfane 3,3'-Dichloro Diphenyl Disulfide 3,3'-DICHLORO DIPHENYL DISULFIDE 1,1'-sulfanediylbis(3-chlorobenzene) 1,1'-disulfanediylbis(3-chlorobenzene) 3,3'-dichlorodiphenyl disulfide 19742-92-8 1-chloro-3-[(3-chlorophenyl)disulfanyl]benzene
|
| CAS | 19742-92-8
|
| InChI | InChI=1/C12H8Cl2S2/c13-9-3-1-5-11(7-9)15-16-12-6-2-4-10(14)8-12/h1-8H |
1-chloro-3-[(3-chlorophenyl)disulfanyl]benzene - Physico-chemical Properties
| Molecular Formula | C12H8Cl2S2
|
| Molar Mass | 287.23 |
| Density | 1.431g/cm3 |
| Boling Point | 373.388°C at 760 mmHg |
| Flash Point | 167.954°C |
| Vapor Presure | 0mmHg at 25°C |
| Refractive Index | 1.695 |
1-chloro-3-[(3-chlorophenyl)disulfanyl]benzene - Introduction
3,3 '-Dichloro Diphenyl Disulfide (DCDPS) is an organic compound with the chemical formula C12H8Cl2S2. The following is an introduction to the nature, use, preparation and safety information of DCDPS:
Nature:
1. Appearance: DCDPS is a white crystalline solid.
2. Melting Point: about 120-122 degrees Celsius.
3. Solubility: DCDPS is almost insoluble in water and has certain solubility in organic solvents.
Use:
1. Functional compounds: DCDPS can be used as functional monomers of polymers for the synthesis of polymer materials with specific properties.
2. Fungicides: DCDPS can be used as fungicides, insecticides and fungicides, used in industry and agriculture.
3. Dye precursor: DCDPS is a precursor compound of some dyes.
Method:
DCDPS has many preparation methods, usually using Diphenyl sulfide as the starting material, chlorination and thioetherification reactions are carried out through chlorination reaction to obtain 3,3 '-Dichloro Diphenyl Disulfide.
Safety Information:
1. DCDPS is an irritating substance, avoid contact with the skin, and avoid inhaling its vapor or dust.
2. When operating DCDPS, personal protective equipment such as protective glasses, gloves and protective masks should be worn.
3. DCDPS may cause pollution to water bodies and the atmosphere, and strict environmental protection requirements should be followed, and appropriate protective measures should be taken during use and treatment.
4. DCDPS should be stored in a dry, ventilated and away from fire.
Last Update:2024-04-10 22:29:15